C18H19ClO5S — CID 7698513
2-(4-chlorophenyl)sulfanylethyl 2,3,4-trimethoxybenzoate (PubChem CID 7698513) has the molecular formula C18H19ClO5S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanylethyl 2,3,4-trimethoxybenzoate.
| Compound Name | 2-(4-chlorophenyl)sulfanylethyl 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 7698513 |
| Molecular Formula | C18H19ClO5S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanylethyl 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCSc2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C18H19ClO5S/c1-21-15-9-8-14(16(22-2)17(15)23-3)18(20)24-10-11-25-13-6-4-12(19)5-7-13/h4-9H,10-11H2,1-3H3 |
| InChIKey | NHDYSDAAGISUQG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|