C28H38O13 — CID 139804932
2-[2-[2-[2-(2,3,4-trimethoxybenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2,3,4-trimethoxybenzoate (PubChem CID 139804932) has the molecular formula C28H38O13 and a molecular weight of 582.60 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,3,4-trimethoxybenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2,3,4-trimethoxybenzoate.
| Compound Name | 2-[2-[2-[2-(2,3,4-trimethoxybenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 139804932 |
| Molecular Formula | C28H38O13 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 2-[2-[2-[2-(2,3,4-trimethoxybenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCOCCOCCOCCOC(=O)c2ccc(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C28H38O13/c1-31-21-9-7-19(23(33-3)25(21)35-5)27(29)40-17-15-38-13-11-37-12-14-39-16-18-41-28(30)20-8-10-22(32-2)26(36-6)24(20)34-4/h7-10H,11-18H2,1-6H3 |
| InChIKey | FXSXYMPXOYNSRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 135.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|