C16H23NO6 — CID 7758376
[2-(tert-butylamino)-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 7758376) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 7758376 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(C)(C)C)c(OC)c1OC |
| InChI | InChI=1S/C16H23NO6/c1-16(2,3)17-12(18)9-23-15(19)10-7-8-11(20-4)14(22-6)13(10)21-5/h7-8H,9H2,1-6H3,(H,17,18) |
| InChIKey | GWPNGAMASJKXIP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |