C17H17ClN2O6 — CID 4792667
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 4792667) has the molecular formula C17H17ClN2O6 and a molecular weight of 380.78 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 4792667 |
| Molecular Formula | C17H17ClN2O6 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(Cl)cn2)c(OC)c1OC |
| InChI | InChI=1S/C17H17ClN2O6/c1-23-12-6-5-11(15(24-2)16(12)25-3)17(22)26-9-14(21)20-13-7-4-10(18)8-19-13/h4-8H,9H2,1-3H3,(H,19,20,21) |
| InChIKey | FVTGILXXZFLKMA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |