C14H11ClN2O5 — CID 7870707
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 7870707) has the molecular formula C14H11ClN2O5 and a molecular weight of 322.70 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870707 |
| Molecular Formula | C14H11ClN2O5 |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H11ClN2O5/c15-8-1-4-12(16-6-8)17-13(20)7-22-14(21)10-3-2-9(18)5-11(10)19/h1-6,18-19H,7H2,(H,16,17,20) |
| InChIKey | JKYHWLUDTREMAD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |