C16H11ClN4O3 — CID 23773548
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate (PubChem CID 23773548) has the molecular formula C16H11ClN4O3 and a molecular weight of 342.74 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23773548 |
| Molecular Formula | C16H11ClN4O3 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnc2ccccc2n1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H11ClN4O3/c17-10-5-6-14(19-7-10)21-15(22)9-24-16(23)13-8-18-11-3-1-2-4-12(11)20-13/h1-8H,9H2,(H,19,21,22) |
| InChIKey | GHKJWDBYSHACCP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |