C17H14N4O3 — CID 23859831
[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate (PubChem CID 23859831) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is [2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23859831 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl] quinoxaline-2-carboxylate |
| SMILES | Cc1ccnc(NC(=O)COC(=O)c2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C17H14N4O3/c1-11-6-7-18-15(8-11)21-16(22)10-24-17(23)14-9-19-12-4-2-3-5-13(12)20-14/h2-9H,10H2,1H3,(H,18,21,22) |
| InChIKey | KQXJIASOSHBDQA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |