C18H12F3N3O3 — CID 30030798
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] quinoxaline-2-carboxylate (PubChem CID 30030798) has the molecular formula C18H12F3N3O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 30030798 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] quinoxaline-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnc2ccccc2n1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3N3O3/c19-18(20,21)11-4-3-5-12(8-11)23-16(25)10-27-17(26)15-9-22-13-6-1-2-7-14(13)24-15/h1-9H,10H2,(H,23,25) |
| InChIKey | VISDVHQZPLEGMP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |