C22H16F3NO4 — CID 2427103
[2-oxo-2-(3-phenoxyanilino)ethyl] 4-(trifluoromethyl)benzoate (PubChem CID 2427103) has the molecular formula C22H16F3NO4 and a molecular weight of 415.37 g/mol. Its IUPAC name is [2-oxo-2-(3-phenoxyanilino)ethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-(3-phenoxyanilino)ethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2427103 |
| Molecular Formula | C22H16F3NO4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-oxo-2-(3-phenoxyanilino)ethyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C(F)(F)F)cc1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H16F3NO4/c23-22(24,25)16-11-9-15(10-12-16)21(28)29-14-20(27)26-17-5-4-8-19(13-17)30-18-6-2-1-3-7-18/h1-13H,14H2,(H,26,27) |
| InChIKey | VCBANZNEWRYASW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |