C18H16F3NO5 — CID 8913496
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 8913496) has the molecular formula C18H16F3NO5 and a molecular weight of 383.32 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8913496 |
| Molecular Formula | C18H16F3NO5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO5/c1-25-14-7-2-3-8-15(14)26-11-17(24)27-10-16(23)22-13-6-4-5-12(9-13)18(19,20)21/h2-9H,10-11H2,1H3,(H,22,23) |
| InChIKey | QGIJCLHWQNKDON-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |