C18H16N2O5 — CID 7854141
[2-(3-cyanoanilino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 7854141) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7854141 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H16N2O5/c1-23-15-7-2-3-8-16(15)24-12-18(22)25-11-17(21)20-14-6-4-5-13(9-14)10-19/h2-9H,11-12H2,1H3,(H,20,21) |
| InChIKey | HNCYCGXGTWNRSY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |