C19H18N2O5 — CID 7605088
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 7605088) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7605088 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H18N2O5/c1-24-16-4-2-3-5-17(16)25-13-19(23)26-12-18(22)21-15-8-6-14(7-9-15)10-11-20/h2-9H,10,12-13H2,1H3,(H,21,22) |
| InChIKey | KPXOLAQXIWVAOX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |