C20H20N2O5 — CID 7630502
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate (PubChem CID 7630502) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 7630502 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)Nc2ccc(CC#N)cc2)ccc1OC |
| InChI | InChI=1S/C20H20N2O5/c1-3-26-18-12-15(6-9-17(18)25-2)20(24)27-13-19(23)22-16-7-4-14(5-8-16)10-11-21/h4-9,12H,3,10,13H2,1-2H3,(H,22,23) |
| InChIKey | IAWJSFIITLOZKN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |