C20H23N3O6 — CID 30028812
[2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(carbamoylamino)benzoate (PubChem CID 30028812) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(carbamoylamino)benzoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 30028812 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-(carbamoylamino)benzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccc(NC(N)=O)cc2)cc1OCC |
| InChI | InChI=1S/C20H23N3O6/c1-3-27-16-10-9-15(11-17(16)28-4-2)22-18(24)12-29-19(25)13-5-7-14(8-6-13)23-20(21)26/h5-11H,3-4,12H2,1-2H3,(H,22,24)(H3,21,23,26) |
| InChIKey | ZPZUIVSDTIHIEQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |