C22H26BrNO7 — CID 30031761
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 30031761) has the molecular formula C22H26BrNO7 and a molecular weight of 496.35 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 30031761 |
| Molecular Formula | C22H26BrNO7 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(Br)c(OCC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C22H26BrNO7/c1-5-28-17-9-8-15(12-18(17)29-6-2)24-20(25)13-31-22(26)14-10-16(23)21(30-7-3)19(11-14)27-4/h8-12H,5-7,13H2,1-4H3,(H,24,25) |
| InChIKey | QAFPJNSLKYBTDY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |