C20H22BrNO5 — CID 18273018
[2-(4-ethylanilino)-2-oxoethyl] 3-bromo-5-ethoxy-4-methoxybenzoate (PubChem CID 18273018) has the molecular formula C20H22BrNO5 and a molecular weight of 436.30 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl] 3-bromo-5-ethoxy-4-methoxybenzoate.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl] 3-bromo-5-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 18273018 |
| Molecular Formula | C20H22BrNO5 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl] 3-bromo-5-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)Nc2ccc(CC)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C20H22BrNO5/c1-4-13-6-8-15(9-7-13)22-18(23)12-27-20(24)14-10-16(21)19(25-3)17(11-14)26-5-2/h6-11H,4-5,12H2,1-3H3,(H,22,23) |
| InChIKey | IXZHTLGNZZWWEK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |