C19H22BrNO3 — CID 3960539
3-bromo-4,5-diethoxy-N-(4-ethylphenyl)benzamide (PubChem CID 3960539) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is 3-bromo-4,5-diethoxy-N-(4-ethylphenyl)benzamide.
| Compound Name | 3-bromo-4,5-diethoxy-N-(4-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 3960539 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 3-bromo-4,5-diethoxy-N-(4-ethylphenyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(CC)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C19H22BrNO3/c1-4-13-7-9-15(10-8-13)21-19(22)14-11-16(20)18(24-6-3)17(12-14)23-5-2/h7-12H,4-6H2,1-3H3,(H,21,22) |
| InChIKey | AKAOQPBKOKKCBR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |