C24H33N2O4+ — CID 7375733
3,4,5-triethoxy-N-[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]benzamide (PubChem CID 7375733) has the molecular formula C24H33N2O4+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 7375733 |
| Molecular Formula | C24H33N2O4+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(C[NH+]3CCCC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H32N2O4/c1-4-28-21-15-19(16-22(29-5-2)23(21)30-6-3)24(27)25-20-11-9-18(10-12-20)17-26-13-7-8-14-26/h9-12,15-16H,4-8,13-14,17H2,1-3H3,(H,25,27)/p+1 |
| InChIKey | VJJFWDSZDZWXBX-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |