C25H34N2O4 — CID 2945862
3,4,5-triethoxy-N-[4-(piperidin-1-ylmethyl)phenyl]benzamide (PubChem CID 2945862) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-(piperidin-1-ylmethyl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-(piperidin-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2945862 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-(piperidin-1-ylmethyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(CN3CCCCC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H34N2O4/c1-4-29-22-16-20(17-23(30-5-2)24(22)31-6-3)25(28)26-21-12-10-19(11-13-21)18-27-14-8-7-9-15-27/h10-13,16-17H,4-9,14-15,18H2,1-3H3,(H,26,28) |
| InChIKey | KFHOJGBKWPOMHM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |