C25H33N3O6 — CID 16611987
3,4,5-triethoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide (PubChem CID 16611987) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 16611987 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(NC(=O)CN3CCOCC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H33N3O6/c1-4-32-21-15-18(16-22(33-5-2)24(21)34-6-3)25(30)27-20-9-7-19(8-10-20)26-23(29)17-28-11-13-31-14-12-28/h7-10,15-16H,4-6,11-14,17H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | KVTJMZNAAJTPTC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |