C23H27N3O6 — CID 15990247
N-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-3,4,5-triethoxybenzamide (PubChem CID 15990247) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 15990247 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3c(c2)n(C)c(=O)c(=O)n3C)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H27N3O6/c1-6-30-18-11-14(12-19(31-7-2)20(18)32-8-3)21(27)24-15-9-10-16-17(13-15)26(5)23(29)22(28)25(16)4/h9-13H,6-8H2,1-5H3,(H,24,27) |
| InChIKey | BXOOCWYXJXNJCK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|