C27H25NO6 — CID 2892221
N-(9,10-dioxoanthracen-2-yl)-3,4,5-triethoxybenzamide (PubChem CID 2892221) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 2892221 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H25NO6/c1-4-32-22-13-16(14-23(33-5-2)26(22)34-6-3)27(31)28-17-11-12-20-21(15-17)25(30)19-10-8-7-9-18(19)24(20)29/h7-15H,4-6H2,1-3H3,(H,28,31) |
| InChIKey | MKQVDSXQKADBBA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|