C20H22N2O4 — CID 1129663
N-(4-cyanophenyl)-3,4,5-triethoxybenzamide (PubChem CID 1129663) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(4-cyanophenyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 1129663 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(4-cyanophenyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(C#N)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H22N2O4/c1-4-24-17-11-15(12-18(25-5-2)19(17)26-6-3)20(23)22-16-9-7-14(13-21)8-10-16/h7-12H,4-6H2,1-3H3,(H,22,23) |
| InChIKey | BFYCJKUZYHOFHC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |