C20H23N3O6S — CID 26980395
N'-(4-cyanophenyl)sulfonyl-3,4,5-triethoxybenzohydrazide (PubChem CID 26980395) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is N'-(4-cyanophenyl)sulfonyl-3,4,5-triethoxybenzohydrazide.
| Compound Name | N'-(4-cyanophenyl)sulfonyl-3,4,5-triethoxybenzohydrazide |
|---|---|
| PubChem CID | 26980395 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N'-(4-cyanophenyl)sulfonyl-3,4,5-triethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNS(=O)(=O)c2ccc(C#N)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H23N3O6S/c1-4-27-17-11-15(12-18(28-5-2)19(17)29-6-3)20(24)22-23-30(25,26)16-9-7-14(13-21)8-10-16/h7-12,23H,4-6H2,1-3H3,(H,22,24) |
| InChIKey | RXTGAMFWEOBEEU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|