C15H14Cl2N2O4S — CID 8617286
N'-(3,5-dichlorophenyl)sulfonyl-4-ethoxybenzohydrazide (PubChem CID 8617286) has the molecular formula C15H14Cl2N2O4S and a molecular weight of 389.26 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)sulfonyl-4-ethoxybenzohydrazide.
| Compound Name | N'-(3,5-dichlorophenyl)sulfonyl-4-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 8617286 |
| Molecular Formula | C15H14Cl2N2O4S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N'-(3,5-dichlorophenyl)sulfonyl-4-ethoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNS(=O)(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2N2O4S/c1-2-23-13-5-3-10(4-6-13)15(20)18-19-24(21,22)14-8-11(16)7-12(17)9-14/h3-9,19H,2H2,1H3,(H,18,20) |
| InChIKey | PNPQHHZWGJDRHX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|