C8H8Cl2N2O4S — CID 8501036
methyl N-[(3,5-dichlorophenyl)sulfonylamino]carbamate (PubChem CID 8501036) has the molecular formula C8H8Cl2N2O4S and a molecular weight of 299.14 g/mol. Its IUPAC name is methyl N-[(3,5-dichlorophenyl)sulfonylamino]carbamate.
| Compound Name | methyl N-[(3,5-dichlorophenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8501036 |
| Molecular Formula | C8H8Cl2N2O4S |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | methyl N-[(3,5-dichlorophenyl)sulfonylamino]carbamate |
| SMILES | COC(=O)NNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2O4S/c1-16-8(13)11-12-17(14,15)7-3-5(9)2-6(10)4-7/h2-4,12H,1H3,(H,11,13) |
| InChIKey | LJOOXSFALIMITQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|