C6H7ClN2O4S2 — CID 8501031
methyl N-[(5-chlorothiophen-2-yl)sulfonylamino]carbamate (PubChem CID 8501031) has the molecular formula C6H7ClN2O4S2 and a molecular weight of 270.72 g/mol. Its IUPAC name is methyl N-[(5-chlorothiophen-2-yl)sulfonylamino]carbamate.
| Compound Name | methyl N-[(5-chlorothiophen-2-yl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8501031 |
| Molecular Formula | C6H7ClN2O4S2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | methyl N-[(5-chlorothiophen-2-yl)sulfonylamino]carbamate |
| SMILES | COC(=O)NNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C6H7ClN2O4S2/c1-13-6(10)8-9-15(11,12)5-3-2-4(7)14-5/h2-3,9H,1H3,(H,8,10) |
| InChIKey | VSXRRSQHTKABRP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|