C8H10ClNO5S2 — CID 43405378
methyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 43405378) has the molecular formula C8H10ClNO5S2 and a molecular weight of 299.76 g/mol. Its IUPAC name is methyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43405378 |
| Molecular Formula | C8H10ClNO5S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | methyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClNO5S2/c1-15-8(12)5(4-11)10-17(13,14)7-3-2-6(9)16-7/h2-3,5,10-11H,4H2,1H3 |
| InChIKey | GQASEXHFMMMCHS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |