C8H10ClN3O5S — CID 61051901
methyl 2-[(2-chloropyrimidin-5-yl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 61051901) has the molecular formula C8H10ClN3O5S and a molecular weight of 295.70 g/mol. Its IUPAC name is methyl 2-[(2-chloropyrimidin-5-yl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(2-chloropyrimidin-5-yl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 61051901 |
| Molecular Formula | C8H10ClN3O5S |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | methyl 2-[(2-chloropyrimidin-5-yl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C8H10ClN3O5S/c1-17-7(14)6(4-13)12-18(15,16)5-2-10-8(9)11-3-5/h2-3,6,12-13H,4H2,1H3 |
| InChIKey | GRMMFSXZBROHFB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |