C9H10BrClN2O5S — CID 61299485
methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 61299485) has the molecular formula C9H10BrClN2O5S and a molecular weight of 373.61 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 61299485 |
| Molecular Formula | C9H10BrClN2O5S |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C9H10BrClN2O5S/c1-18-9(15)6(4-14)13-19(16,17)7-2-5(10)3-12-8(7)11/h2-3,6,13-14H,4H2,1H3 |
| InChIKey | LRYWMFPIIXUSSX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|