C10H14BrClN2O3S — CID 115755260
5-bromo-2-chloro-N-(1-hydroxypentan-3-yl)pyridine-3-sulfonamide (PubChem CID 115755260) has the molecular formula C10H14BrClN2O3S and a molecular weight of 357.66 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(1-hydroxypentan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(1-hydroxypentan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115755260 |
| Molecular Formula | C10H14BrClN2O3S |
| Molecular Weight | 357.66 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 5-bromo-2-chloro-N-(1-hydroxypentan-3-yl)pyridine-3-sulfonamide |
| SMILES | CCC(CCO)NS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H14BrClN2O3S/c1-2-8(3-4-15)14-18(16,17)9-5-7(11)6-13-10(9)12/h5-6,8,14-15H,2-4H2,1H3 |
| InChIKey | CIXWGXRUQUBWSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.66 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|