C9H12BrClN2O5S — CID 114009086
5-bromo-2-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]pyridine-3-sulfonamide (PubChem CID 114009086) has the molecular formula C9H12BrClN2O5S and a molecular weight of 375.63 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114009086 |
| Molecular Formula | C9H12BrClN2O5S |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 5-bromo-2-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC(CO)(CO)CO)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C9H12BrClN2O5S/c10-6-1-7(8(11)12-2-6)19(17,18)13-9(3-14,4-15)5-16/h1-2,13-16H,3-5H2 |
| InChIKey | QCDDUTUNMNCACX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|