C7H7BrClN3O4S — CID 107856770
2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]oxyacetamide (PubChem CID 107856770) has the molecular formula C7H7BrClN3O4S and a molecular weight of 344.57 g/mol. Its IUPAC name is 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 107856770 |
| Molecular Formula | C7H7BrClN3O4S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 342.90 |
| IUPAC Name | 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]oxyacetamide |
| SMILES | NC(=O)CONS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C7H7BrClN3O4S/c8-4-1-5(7(9)11-2-4)17(14,15)12-16-3-6(10)13/h1-2,12H,3H2,(H2,10,13) |
| InChIKey | OKMHLCUHVINUSH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|