C6H6BrClN2O4S2 — CID 112673433
2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]oxyacetamide (PubChem CID 112673433) has the molecular formula C6H6BrClN2O4S2 and a molecular weight of 349.62 g/mol. Its IUPAC name is 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673433 |
| Molecular Formula | C6H6BrClN2O4S2 |
| Molecular Weight | 349.62 g/mol |
| Exact Mass | 347.86 |
| IUPAC Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]oxyacetamide |
| SMILES | NC(=O)CONS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C6H6BrClN2O4S2/c7-6-3(8)1-5(15-6)16(12,13)10-14-2-4(9)11/h1,10H,2H2,(H2,9,11) |
| InChIKey | PTVLDXWATSXQJG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|