C8H9BrClNO4S2 — CID 80577604
(2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]butanoic acid (PubChem CID 80577604) has the molecular formula C8H9BrClNO4S2 and a molecular weight of 362.65 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 80577604 |
| Molecular Formula | C8H9BrClNO4S2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 360.88 |
| IUPAC Name | (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1cc(Cl)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C8H9BrClNO4S2/c1-2-5(8(12)13)11-17(14,15)6-3-4(10)7(9)16-6/h3,5,11H,2H2,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | XANPSAAQXYYAOK-RXMQYKEDSA-N |
| XLogP | 2.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |