C8H9BrClNO5S2 — CID 104934085
(2S)-4-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 104934085) has the molecular formula C8H9BrClNO5S2 and a molecular weight of 378.65 g/mol. Its IUPAC name is (2S)-4-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104934085 |
| Molecular Formula | C8H9BrClNO5S2 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 376.88 |
| IUPAC Name | (2S)-4-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(O)[C@@H](O)CCNS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C8H9BrClNO5S2/c9-7-4(10)3-6(17-7)18(15,16)11-2-1-5(12)8(13)14/h3,5,11-12H,1-2H2,(H,13,14)/t5-/m0/s1 |
| InChIKey | SEGGOJROVCKZJX-YFKPBYRVSA-N |
| XLogP | 1.28 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |