C10H12BrClN2O3S2 — CID 115685407
N-[2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]ethyl]cyclopropanecarboxamide (PubChem CID 115685407) has the molecular formula C10H12BrClN2O3S2 and a molecular weight of 387.71 g/mol. Its IUPAC name is N-[2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115685407 |
| Molecular Formula | C10H12BrClN2O3S2 |
| Molecular Weight | 387.71 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | N-[2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cc(Cl)c(Br)s1)C1CC1 |
| InChI | InChI=1S/C10H12BrClN2O3S2/c11-9-7(12)5-8(18-9)19(16,17)14-4-3-13-10(15)6-1-2-6/h5-6,14H,1-4H2,(H,13,15) |
| InChIKey | CIAQMWOASPHRHD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.71 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|