C9H11BrClNO3S2 — CID 80577895
5-bromo-4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)thiophene-2-sulfonamide (PubChem CID 80577895) has the molecular formula C9H11BrClNO3S2 and a molecular weight of 360.68 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577895 |
| Molecular Formula | C9H11BrClNO3S2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-cyclopropyl-2-hydroxyethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)C1CC1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H11BrClNO3S2/c10-9-6(11)3-8(16-9)17(14,15)12-4-7(13)5-1-2-5/h3,5,7,12-13H,1-2,4H2 |
| InChIKey | BBIREVBYBSLVKT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |