C10H13BrClNO4S2 — CID 80577423
2-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]-3-methylbutanoic acid (PubChem CID 80577423) has the molecular formula C10H13BrClNO4S2 and a molecular weight of 390.71 g/mol. Its IUPAC name is 2-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]-3-methylbutanoic acid.
| Compound Name | 2-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 80577423 |
| Molecular Formula | C10H13BrClNO4S2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2-[[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNS(=O)(=O)c1cc(Cl)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H13BrClNO4S2/c1-5(2)6(10(14)15)4-13-19(16,17)8-3-7(12)9(11)18-8/h3,5-6,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | GSZGQNXXSHKHMC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |