C11H17NO4S2 — CID 65221421
3-methyl-2-[[(5-methylthiophen-2-yl)sulfonylamino]methyl]butanoic acid (PubChem CID 65221421) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-methyl-2-[[(5-methylthiophen-2-yl)sulfonylamino]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(5-methylthiophen-2-yl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65221421 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-methyl-2-[[(5-methylthiophen-2-yl)sulfonylamino]methyl]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C(=O)O)C(C)C)s1 |
| InChI | InChI=1S/C11H17NO4S2/c1-7(2)9(11(13)14)6-12-18(15,16)10-5-4-8(3)17-10/h4-5,7,9,12H,6H2,1-3H3,(H,13,14) |
| InChIKey | JLAOQEHIPZQMQX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |