C9H16N2O2S2 — CID 120825500
5-methyl-N-[2-(methylamino)propyl]thiophene-2-sulfonamide (PubChem CID 120825500) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-methyl-N-[2-(methylamino)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-(methylamino)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 120825500 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 5-methyl-N-[2-(methylamino)propyl]thiophene-2-sulfonamide |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-7(10-3)6-11-15(12,13)9-5-4-8(2)14-9/h4-5,7,10-11H,6H2,1-3H3 |
| InChIKey | WDRUBFUCKBVTHQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |