C15H27N3O2S2 — CID 56685915
5-methyl-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]thiophene-2-sulfonamide (PubChem CID 56685915) has the molecular formula C15H27N3O2S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 5-methyl-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56685915 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-methyl-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C(C)C)N2CCN(C)CC2)s1 |
| InChI | InChI=1S/C15H27N3O2S2/c1-12(2)14(18-9-7-17(4)8-10-18)11-16-22(19,20)15-6-5-13(3)21-15/h5-6,12,14,16H,7-11H2,1-4H3 |
| InChIKey | NGJDEPCIGMCLHI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |