C20H30N4O2S2 — CID 7498370
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 7498370) has the molecular formula C20H30N4O2S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7498370 |
| Molecular Formula | C20H30N4O2S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](c2ccc(N(C)C)cc2)N2CCN(C)CC2)s1 |
| InChI | InChI=1S/C20H30N4O2S2/c1-16-5-10-20(27-16)28(25,26)21-15-19(24-13-11-23(4)12-14-24)17-6-8-18(9-7-17)22(2)3/h5-10,19,21H,11-15H2,1-4H3/t19-/m1/s1 |
| InChIKey | PLFCUZBUUZDOLD-LJQANCHMSA-N |
| XLogP | 2.39 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|