C24H29FN4O2S2 — CID 43957215
N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 43957215) has the molecular formula C24H29FN4O2S2 and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43957215 |
| Molecular Formula | C24H29FN4O2S2 |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2cccs2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H29FN4O2S2/c1-27(2)21-9-5-19(6-10-21)23(18-26-33(30,31)24-4-3-17-32-24)29-15-13-28(14-16-29)22-11-7-20(25)8-12-22/h3-12,17,23,26H,13-16,18H2,1-2H3 |
| InChIKey | MXNVMYTWKUPTSR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|