C20H26FN3O2S — CID 7498058
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-4-fluorobenzenesulfonamide (PubChem CID 7498058) has the molecular formula C20H26FN3O2S and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 7498058 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-4-fluorobenzenesulfonamide |
| SMILES | CN(C)c1ccc([C@@H](CNS(=O)(=O)c2ccc(F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H26FN3O2S/c1-23(2)18-9-5-16(6-10-18)20(24-13-3-4-14-24)15-22-27(25,26)19-11-7-17(21)8-12-19/h5-12,20,22H,3-4,13-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | LRFFYYJAYDVPCP-HXUWFJFHSA-N |
| XLogP | 3.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|