C20H26FN3O2S — CID 30631191
N-[(2R)-2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 30631191) has the molecular formula C20H26FN3O2S and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 30631191 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H](c2ccc(F)cc2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H26FN3O2S/c1-16-3-9-19(10-4-16)27(25,26)22-15-20(17-5-7-18(21)8-6-17)24-13-11-23(2)12-14-24/h3-10,20,22H,11-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | VAJWCZOEATXPMX-FQEVSTJZSA-N |
| XLogP | 2.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |