C25H28FN3O5S — CID 70895265
N-[2-(3,4-dihydroxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-fluorophenoxy)benzenesulfonamide (PubChem CID 70895265) has the molecular formula C25H28FN3O5S and a molecular weight of 501.58 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-fluorophenoxy)benzenesulfonamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-fluorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 70895265 |
| Molecular Formula | C25H28FN3O5S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(4-fluorophenoxy)benzenesulfonamide |
| SMILES | CN1CCN(C(CNS(=O)(=O)c2ccc(Oc3ccc(F)cc3)cc2)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C25H28FN3O5S/c1-28-12-14-29(15-13-28)23(18-2-11-24(30)25(31)16-18)17-27-35(32,33)22-9-7-21(8-10-22)34-20-5-3-19(26)4-6-20/h2-11,16,23,27,30-31H,12-15,17H2,1H3 |
| InChIKey | NBJQICLFGAMUAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|