C26H28N4O3S — CID 45275453
N-[2-(4-cyanophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide (PubChem CID 45275453) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[2-(4-cyanophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[2-(4-cyanophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 45275453 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[2-(4-cyanophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
| SMILES | CN1CCN(C(CNS(=O)(=O)c2ccc(Oc3ccccc3)cc2)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C26H28N4O3S/c1-29-15-17-30(18-16-29)26(22-9-7-21(19-27)8-10-22)20-28-34(31,32)25-13-11-24(12-14-25)33-23-5-3-2-4-6-23/h2-14,26,28H,15-18,20H2,1H3 |
| InChIKey | ULWOQCRQUYAQGI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |