C26H31N3O3S — CID 45275010
N-[2-(2-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide (PubChem CID 45275010) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[2-(2-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 45275010 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[2-(2-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
| SMILES | Cc1ccccc1C(CNS(=O)(=O)c1ccc(Oc2ccccc2)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C26H31N3O3S/c1-21-8-6-7-11-25(21)26(29-18-16-28(2)17-19-29)20-27-33(30,31)24-14-12-23(13-15-24)32-22-9-4-3-5-10-22/h3-15,26-27H,16-20H2,1-2H3 |
| InChIKey | VNWIPTQKTDHUSC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |