C25H28ClN3O3S — CID 45275234
N-[(2R)-2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide (PubChem CID 45275234) has the molecular formula C25H28ClN3O3S and a molecular weight of 486.04 g/mol. Its IUPAC name is N-[(2R)-2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[(2R)-2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 45275234 |
| Molecular Formula | C25H28ClN3O3S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | N-[(2R)-2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-4-phenoxybenzenesulfonamide |
| SMILES | CN1CCN([C@@H](CNS(=O)(=O)c2ccc(Oc3ccccc3)cc2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C25H28ClN3O3S/c1-28-15-17-29(18-16-28)25(23-9-5-6-10-24(23)26)19-27-33(30,31)22-13-11-21(12-14-22)32-20-7-3-2-4-8-20/h2-14,25,27H,15-19H2,1H3/t25-/m0/s1 |
| InChIKey | MIQPFYBQNWUFCN-VWLOTQADSA-N |
| XLogP | 4.40 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |